Sắc tố vàng 3
| tên sản phẩm | HEO VÀNG 3 |
| Từ đồng nghĩa: | Màu vàng 3; CIPY3; PY3; PY3 |
| CI. | 11710 |
| CAS KHÔNG. | 6486-23-3 |
| EINECS | 229-355-1 |
| Trọng lượng phân tử | 395.2 |
| Công thức phân tử | C16H12Cl2N4O4 |
| Màu sắc: | Bột màu vàng |
Công thức cấu tạo phân tử:
Tính chất độ bền của bột màu vàng 3:
| Độ bền ánh sáng | 6-7 |
| Khả năng chịu nhiệt (℃) | 140 |
| Không thấm nước | 4-5 |
| Chống dầu | 3-4 |
| Kháng axit | 4-5 |
| Kháng kiềm | 4-5 |
| Kháng cồn | 4 |
Light yellow powder, bright color, melting point 258 ℃, kept stable at 150 ℃ for 20min, can be dissolved in ethanol, acetone and other organic solvents when heated, yellow in case of concentrated sulfuric acid, unchanged in color in concentrated nitric acid, concentrated hydrochloric acid and dilute sodium hydroxide, and has good light and heat resistance.
Ứng dụng chính: Sơn & lớp phủ
Chúng tôi có nhiều loại bột màu và đặc tính khác nhau để đáp ứng các nhu cầu khác nhau của khách hàng, vui lòng nêu rõ ứng dụng và yêu cầu của bạn để chúng tôi có thể đề xuất phù hợp. E-mail: sy@sypigment.com
Mô tả sản phẩm của Pigment Yellow 3:
Sắc tố Vàng 3 có thể được kết hợp với các sắc tố màu xanh lam (như đồng phthalocyanin CuPc) để tạo ra màu xanh lục. Nó có diện tích bề mặt thấp (diện tích bề mặt riêng của Hansa Yellow 10G là 8m2 / g), khả năng ẩn cao và độ bền ánh sáng tuyệt vời. Được sử dụng cho sơn làm khô bằng không khí, sơn latex, bột màu in và mực in bao bì, xà phòng, văn phòng phẩm, vv.
Chủ yếu được sử dụng để tạo màu sơn, mực in, sơn in, vật tư văn hóa và giáo dục và các sản phẩm nhựa.
Pigment Yellow 3 is a pigment with good fastness to light and weathering for air-drying paints. Because of its pure greenish shade it is particularly suitable for green mixtures. Owing to the high risk of blooming, it is not suitable for stoving enamels.
TDS (Pigment Yellow 3) MSDS (Pigment Yellow 3)Từ đồng nghĩa
| 1. Pigment yellow 3 | 54. Iroquois Yellow X-1285 |
| 2. 6486-23-3 | 55. Recolite Fast Yellow 10G |
| 3. C.I. Pigment Yellow 3 | 56. Segnale Light Yellow 10G |
| 4. Yellow pigment | 57. Tertropigment Yellow 10GT |
| 5. PigmentYellow3 | 58. Toluidine Yellow AH 177 |
| 6. Pigment Yellow 2Z | 59. Symuler Fast Yellow 10GH |
| 7. Fast Yellow 10J | 60. Irgalite Fast Yellow P10G |
| 8. Fast Yellow 15J | 61. Monolite Fast Yellow 10GA |
| 9. Irgalite Yellow VG | 62. Monolite Fast Yellow 10GV |
| 10. Monolite Fast Yellow 10G | 63. Recolite Fast Yellow 10GT |
| 11. Polymo Yellow F7G | 64. Permanent Yellow Toner 10G |
| 12. Fast Yellow 10JT | 65. Monolite Fast Yellow 10GBA |
| 13. Irgalite Yellow VGT | 66. Eljon Fast Primrose PV Extra |
| 14. Irgalite Yellow VGX | 67. Pigment Lightfast Yellow 2ZTP |
| 15. Siegle Yellow 10G | 68. Fanchon Yellow (10G) YH-4 |
| 16. Versal Yellow 10G | 69. Monolite Fast Paper Yellow 10G |
| 17. Vulcol Yellow 10G | 70. Permanent Yellow 10G YT-372 |
| 18. Fastona Yellow 10G | 71. C.I. 11710 |
| 19. Hansa Yellow 10GD | 72. Phthalocyanine Light Fast Yellow 2Z |
| 20. Hansa Yellow 10GT | 73. Pigment Phthalocyanine Light Fast Yellow 2Z |
| 21. Irgalite Yellow PV4 | 74. 2-[(4-Chloro-2-nitrophenyl)azo]-N-(2-chlorophenyl)-3-oxobutyramide |
| 22. Oralith Yellow 10G | 75. 2-[(4-chloro-2-nitrophenyl)diazenyl]-N-(2-chlorophenyl)-3-oxobutanamide |
| 23. Pigment Yellow 10G | 76. Butanamide, 2-[(4-chloro-2-nitrophenyl)azo]-N-(2-chlorophenyl)-3-oxo- |
| 24. Silopol Yellow 10G | 77. 2-((4-Chloro-2-nitrophenyl)azo)-N-(2-chlorophenyl)-3-oxobutyramide |
| 25. Hostaperm Yellow IOG | 78. Butanamide, 2-((4-chloro-2-nitrophenyl)azo)-N-(2-chlorophenyl)-3-oxo- |
| 26. Pigment Yellow 2ZTP | 79. Butanamide, 2-[2-(4-chloro-2-nitrophenyl)diazenyl]-N-(2-chlorophenyl)-3-oxo- |
| 27. Carnelio Yellow 10G | 80. C16H12Cl2N4O4 |
| 28. Hansa Yellow 10-G | 81. Butanamide, 2-(2-(4-chloro-2-nitrophenyl)diazenyl)-N-(2-chlorophenyl)-3-oxo- |
| 29. Irgalite Yellow 10G | 82. EINECS 229-355-1 |
| 30. Monolite Yellow 10G | 83. Hansa Yellow 10G |
| 31. Permansa Yellow 10G | 84. NSC 17264 |
| 32. Silosol Yellow 10GN | 85. CI 11710 |
| 33. Arylamide Yellow 10G | 86. Nano Pigment Yellow 3 |
| 34. Chromatex Yellow 10J | 87. EC 229-355-1 |
| 35. Graphtol Yellow 10GL | 88. SCHEMBL340984 |
| 36. Hancock Yellow 1007 | 89. SCHEMBL12760919 |
| 37. Siloton Yellow 10GCL | 90. SCHEMBL12760920 |
| 38. Helio Fast Yellow 8GM | 91. DTXSID40863873 |
| 39. Isol Aryl Yellow 10G | 92. C.I. Pigment Yellow 3 (VAN) |
| 40. Mono Fast Yellow 10G | 93. NSC17264 |
| 41. Eljon Fast Yellow 10G | 94. MFCD00071936 |
| 42. Sanyo Fast Yellow 10G | 95. NSC-17264 |
| 43. Syton Fast Yellow 10G | 96. AKOS025310987 |
| 44. Hansa Yellow 10G extra | 97. AKOS037643361 |
| 45. Isol Aryl Yellow 10GX | 98. Pigment Yellow 3, analytical standard |
| 46. Hansa Yellow 10G Toner | 99. AS-15319 |
| 47. Eljon Fast Yellow 10GX | 100. O867 |
| 48. Tertropigment Yellow 10G | 101. C.I.11710 |
| 49. ADC Pigment Yellow 10G | 102. A923734 |
| 50. Kromon Yellow 10G Extra | 103. Q27282827 |
| 51. Lutetia Fast Yellow 10J | 104. 2-((4-Chloro-2-nitrophenyl)azo)-N-(2-chlorophenyl)-3-oxobutanamid- e |
| 52. Lutetia Fast Yellow 12J | 105. 2-((4-Chloro-2-nitrophenyl)azo)-N-(2-chlorophpenyl)-3-oxobutanami- de |
| 53. Dainichi Fast Yellow 10G | 106. 2-(4-Chloro-2-nitro-phenylazo)-N-(2-chloro-phenyl)-3-oxo-butyramide |
IUPAC Name: 2-[(4-chloro-2-nitrophenyl)diazenyl]-N-(2-chlorophenyl)-3-oxobutanamide
InChI: InChI=1S/C16H12Cl2N4O4/c1-9(23)15(16(24)19-12-5-3-2-4-11(12)18)21-20-13-7-6-10(17)8-14(13)22(25)26/h2-8,15H,1H3,(H,19,24)
InChIKey: QTSNFLIDNYOATQ-UHFFFAOYSA-N
Canonical SMILES: CC(=O)C(C(=O)NC1=CC=CC=C1Cl)N=NC2=C(C=C(C=C2)Cl)[N+](=O)[O-]
| Property Name | Property Value |
| Molecular Weight | 395.2 |
| XLogP3-AA | 4.6 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 5 |
| Exact Mass | 394.0235603 |
| Monoisotopic Mass | 394.0235603 |
| Topological Polar Surface Area | 117 Ų |
| Heavy Atom Count | 26 |
| Formal Charge | 0 |
| Complexity | 569 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Covalently-Bonded Unit Count | 1 |
| Compound Is Canonicalized | Yes |
